Molecular Definition

Canonical SMILES CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C)C(C)(C)C
Formula C27H45N5O5
Molecular Weight 519.68 da
Stereocenters 4/5