Molecular Definition

Canonical SMILES CC(C)(OC1=CC=C(CCNC(=O)C2=CC=C(Cl)C=C2)C=C1)C(O)=O
Formula C19H20ClNO4
Molecular Weight 361.82 da
Stereocenters 0/0