Molecular Definition

Canonical SMILES N\C(=N/C(=O)c1nc(Cl)c(N)nc1N)\NCc2ccccc2
Formula C13H14ClN7O
Molecular Weight 319.75 da
Stereocenters 0/0