Molecular Definition

Canonical SMILES [H][C@@]12C[C@H](C)[C@](OC(=O)CC)(C(=O)COC(=O)CC)[C@@]1(C)C[C@H](O)[C@@]1(Cl)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C
Formula C28H37ClO7
Molecular Weight 521.04 da
Stereocenters 8/8