Molecular Definition

Canonical SMILES Oc1ccc(cc1)C(=O)N[C@@H]1CNCCC[C@H]1OC(=O)c1cc(O)c(c(c1)O)C(=O)c1c(O)cccc1C(=O)O
Formula C28H26N2O10
Molecular Weight 550.51 da
Stereocenters 2/2