Molecular Definition

Canonical SMILES CN1CCCC(CC1)N2N=C(Cc3ccc(Cl)cc3)c4ccccc4C2=O
Formula C22H24ClN3O
Molecular Weight 381.90 da
Stereocenters 0/1