axitinib
oral Angiogenesis Inhibitor that inhibits the tyrosine kinase activities of both VEGFR and PDGFRbeta
Target Relevance
| Vascular endothelial growth factor receptor 1 | Tclin |
| INHIBITOR 542 | |
| pKd 2908 | 8.24 |
| pKd 2908 | 8.24 |
| Aurora kinase C | Tchem |
| pKd 2908 | 8.89 |
| pKd 2908 | 8.89 |
| Tyrosine-protein kinase ABL1 | Tclin |
| pKd 2908 | 7.64 |
| Serine/threonine-protein kinase PLK4 | Tchem |
| pKi 70819 | 8.38 |
| pKd 2908 | 7.8 |
| Platelet-derived growth factor receptor beta | Tclin |
| pKd 2908 | 9.24 |
| Mast/stem cell growth factor receptor Kit | Tclin |
| pKd 2908 | 8.46 |
| Vascular endothelial growth factor receptor 2 | Tclin |
| pKd 2908 | 8.23 |
| Aurora kinase B | Tchem |
| pKd 2908 | 7.96 |
| Macrophage colony-stimulating factor 1 receptor | Tclin |
| pKd 2908 | 7.68 |
| Platelet-derived growth factor receptor alpha | Tclin |
| pKd 2908 | 9.29 |
Molecular Definition
| Canonical SMILES | CNC(=O)C1=C(SC2=CC=C3C(NN=C3\C=C\C3=CC=CC=N3)=C2)C=CC=C1 |
| Formula | C22H18N4OS |
| Molecular Weight | 386.47 da |
| Stereocenters | 0/0 |