axitinib
oral Angiogenesis Inhibitor that inhibits the tyrosine kinase activities of both VEGFR and PDGFRbeta
Target Relevance
Vascular endothelial growth factor receptor 1 | Tclin |
INHIBITOR 542 | |
pKd 2908 | 8.24 |
pKd 2908 | 8.24 |
Aurora kinase C | Tchem |
pKd 2908 | 8.89 |
pKd 2908 | 8.89 |
Tyrosine-protein kinase ABL1 | Tclin |
pKd 2908 | 7.64 |
Serine/threonine-protein kinase PLK4 | Tchem |
pKi 70819 | 8.38 |
pKd 2908 | 7.8 |
Platelet-derived growth factor receptor beta | Tclin |
pKd 2908 | 9.24 |
Mast/stem cell growth factor receptor Kit | Tclin |
pKd 2908 | 8.46 |
Vascular endothelial growth factor receptor 2 | Tclin |
pKd 2908 | 8.23 |
Aurora kinase B | Tchem |
pKd 2908 | 7.96 |
Macrophage colony-stimulating factor 1 receptor | Tclin |
pKd 2908 | 7.68 |
Platelet-derived growth factor receptor alpha | Tclin |
pKd 2908 | 9.29 |
Molecular Definition
Canonical SMILES | CNC(=O)C1=C(SC2=CC=C3C(NN=C3\C=C\C3=CC=CC=N3)=C2)C=CC=C1 |
Formula | C22H18N4OS |
Molecular Weight | 386.47 da |
Stereocenters | 0/0 |