Molecular Definition

Canonical SMILES [H]C12CN(C)CC1([H])C1=C(OC3=C2C=CC=C3)C=CC(Cl)=C1
Formula C17H16ClNO
Molecular Weight 285.77 da
Stereocenters 0/2