Molecular Definition

Canonical SMILES NC1=CC(Cl)=C(NC2=NCCN2)C(Cl)=C1
Formula C9H10Cl2N4
Molecular Weight 245.11 da
Stereocenters 0/0