Molecular Definition

Canonical SMILES [H]C1(C2=C(Cl)C=CC=C2)C(C(=O)OC)=C(C)NC(COCCN)=C1C(=O)OCC
Formula C20H25ClN2O5
Molecular Weight 408.88 da
Stereocenters 0/1