Molecular Definition

Canonical SMILES COC1=C(OC)C=C2C(N)=NC(=NC2=C1)N(C)CCCNC(=O)C1CCCO1
Formula C19H27N5O4
Molecular Weight 389.45 da
Stereocenters 0/1