Molecular Definition

Canonical SMILES Nc1ncnc2c1ncn2[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O
Formula C10H13N5O4
Molecular Weight 267.24 da
Stereocenters 4/4