Molecular Definition

Canonical SMILES CC(OC(C)=O)C(=O)OCC[N+](C)(C)C
Formula C10H20NO4
Molecular Weight 218.27 da
Stereocenters 0/2