Molecular Definition

Canonical SMILES [H][C@@]1(C[C@H](O)[C@H](O[C@@]2([H])C[C@H](O)[C@H](O[C@@]3([H])C[C@H](OC(C)=O)[C@H](O)[C@@H](C)O3)[C@@H](C)O2)[C@@H](C)O1)O[C@H]1CC[C@@]2(C)[C@]([H])(CC[C@]3([H])[C@]2([H])CC[C@]2(C)[C@H](CC[C@]32O)C2=CC(=O)OC2)C1
Formula C43H66O14
Molecular Weight 806.98 da
Stereocenters 20/20