Target Relevance

Molecular Definition

Canonical SMILES CC(=O)C1=CC=C2SC3=CC=CC=C3N(CCCN3CCN(CCO)CC3)C2=C1
Formula C23H29N3O2S
Molecular Weight 411.56 da
Stereocenters 0/0