Molecular Definition

Canonical SMILES [H][C@]1(N[C@@H]2[C@@H](C)O[C@H](O[C@]3([H])[C@@H](CO)O[C@H](O[C@]4([H])[C@@H](CO)OC(O)[C@H](O)[C@H]4O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)C=C(CO)[C@@H](O)[C@H](O)[C@H]1O
Formula C25H43NO18
Molecular Weight 645.60 da
Stereocenters 18/19