Target Relevance

Molecular Definition

Canonical SMILES O=C(N(Cc1cccc(c1)c1ccncc1)C)Oc1ccc(cc1)c1ccc(cc1)C(=O)N
Formula C27H23N3O3
Molecular Weight 437.49 da
Stereocenters 0/0