Target Relevance

Molecular Definition

Canonical SMILES O=C(N(Cc1cccc(c1)c1ccccc1)C)Oc1cccc(c1)c1ccc(cc1)C(=O)N
Formula C28H24N2O3
Molecular Weight 436.50 da
Stereocenters 0/0