Molecular Definition

Canonical SMILES CCCCn1c(=O)c(NC(=O)Nc2c(cc(cc2C(C)C)N)C(C)C)c(c2c1nccc2)c1cccc(c1)OCCCO
Formula C34H43N5O4
Molecular Weight 585.74 da
Stereocenters 0/0