Molecular Definition

Canonical SMILES CCCCn1c(=O)c(NC(=O)Nc2c(cccc2C(C)C)C(C)C)c(c2c1nccc2)c1cccc(c1)OC
Formula C32H38N4O3
Molecular Weight 526.67 da
Stereocenters 0/0