Molecular Definition

Canonical SMILES CN1CCC(CC1)CNc1ccc2n(n1)c(cn2)c1cccc(c1)OC(F)(F)F
Formula C20H22F3N5O
Molecular Weight 405.42 da
Stereocenters 0/0