Target Relevance

Molecular Definition

Canonical SMILES O=C1C=CC=C/C/1=C\C=c\1/ccc2c([nH]1)cccc2
Formula C17H13NO
Molecular Weight 247.29 da
Stereocenters 0/0