Molecular Definition

Canonical SMILES OCc1c(cccc1n1ccc2c(c1=O)c(F)cc(c2)C1CC1)c1cc(Nc2ccc(cn2)N2CCN(CC2)C)c(=O)n(c1)C
Formula C35H35FN6O3
Molecular Weight 606.69 da
Stereocenters 0/0