Target Relevance

Molecular Definition

Canonical SMILES Cc1cnc(nc1NCc1ccc(cc1)n1nncc1)c1ccccc1C(C)C
Formula C23H24N6
Molecular Weight 384.48 da
Stereocenters 0/0