Target Relevance

Mucolipin-1 Tchem
pEC50 8212 6.96000004

Molecular Definition

Canonical SMILES Cc1ccc(s1)S(=O)(=O)Nc1ccccc1N1CCCCC1
Formula C16H20N2O2S2
Molecular Weight 336.47 da
Stereocenters 0/0