Molecular Definition

Canonical SMILES O[C@H]1C[C@H](O)C(=C)/C(=C\C=C\2/CCC[C@]3(C2CC=C3[C@@H](CCS(=O)(=N)c2ccccc2)C)C)/C1
Formula C29H39NO3S
Molecular Weight 481.69 da
Stereocenters 4/5