Molecular Definition

Canonical SMILES C/C(=c/1\[nH]c(c[nH]1)[C@H]([C@@H]([C@@H](CO)O)O)O)/N=O
Formula C9H13N3O5
Molecular Weight 243.22 da
Stereocenters 3/3