Molecular Definition

Canonical SMILES OC1C(OP(=S)(O)O)C(OP(=S)(O)O)C(C(C1O)OP(=O)(O)O)O
Formula C6H15O13P3S2
Molecular Weight 452.23 da
Stereocenters 0/6