Molecular Definition

Canonical SMILES COC(=O)c1sc(cc1NC(=O)/C=C/C(=O)O)c1cccs1
Formula C14H11NO5S2
Molecular Weight 337.37 da
Stereocenters 0/0