Molecular Definition

Canonical SMILES OC(=O)c1ccc(cc1C1CCCC1)c1c[nH]c2c1cc(cn2)c1ccccc1
Formula C25H22N2O2
Molecular Weight 382.45 da
Stereocenters 0/0