Molecular Definition

Canonical SMILES CCOC(=O)CCNc1cc(nc(n1)c1ccccn1)N1CCc2c(CC1)cccc2
Formula C24H27N5O2
Molecular Weight 417.50 da
Stereocenters 0/0