Target Relevance

Molecular Definition

Canonical SMILES CSCC[C@@H](C(=O)O)NC(=O)c1ccc(cc1c1ccccc1)NC[C@H](CS)N
Formula C21H27N3O3S2
Molecular Weight 433.59 da
Stereocenters 2/2