Molecular Definition

Canonical SMILES N[C@@H]([C@@H](C(=O)O)OCc1ccccc1)C(=O)O
Formula C11H13NO5
Molecular Weight 239.22 da
Stereocenters 2/2