Molecular Definition

Canonical SMILES FC(c1ccc2c(c1)[C@H]1CNC[C@@H]2C1)(F)F
Formula C12H12F3N
Molecular Weight 227.23 da
Stereocenters 2/2