Molecular Definition

Canonical SMILES C[C@H]([C@@H](NC(=O)N1CCC(CC1)n2c(O)nc3ccccc23)C(=O)N[C@@H](CCCCN)C(=O)OC(C)(C)C)c4c[nH]c5ccccc45
Formula C35H47N7O5
Molecular Weight 645.79 da
Stereocenters 3/3