Molecular Definition

Canonical SMILES NCCCC[C@H](NC(=O)CN(CCc1ccccc1)C(=O)CCc2ccccc2)B(O)O
Formula C24H34BN3O4
Molecular Weight 439.36 da
Stereocenters 1/1