Molecular Definition

Canonical SMILES C[C@H](\C=C(/C)\C=C\C(=O)NO)C(=O)c1ccc(cc1)N(C)C
Formula C17H22N2O3
Molecular Weight 302.37 da
Stereocenters 1/1