Target Relevance

Molecular Definition

Canonical SMILES Clc1ccc(Sc2ccc(NC3=NCCN3)cc2)cc1
Formula C15H14ClN3S
Molecular Weight 303.81 da
Stereocenters 0/0