Target Relevance

Molecular Definition

Canonical SMILES COc1cc2OCC3C(CN4CCN(Cc5ccccc5)CC4)ON=C3c2cc1OC
Formula C24H29N3O4
Molecular Weight 423.50 da
Stereocenters 0/2