Target Relevance

Molecular Definition

Canonical SMILES CC(C)C[C@H](NC(=O)C(=O)Nc1cccc2ccccc12)C(=O)N[C@@H](CC(=O)O)C=O
Formula C22H25N3O6
Molecular Weight 427.45 da
Stereocenters 2/2