Molecular Definition

Canonical SMILES O=C(NCCCn1ccnc1)c2oc3ccccc3c2
Formula C15H15N3O2
Molecular Weight 269.30 da
Stereocenters 0/0