Target Relevance

Molecular Definition

Canonical SMILES Oc1ccc(NC(=O)c2ccc(NCc3ccccc3O)cc2)cc1O
Formula C20H18N2O4
Molecular Weight 350.37 da
Stereocenters 0/0