Molecular Definition

Canonical SMILES Cc1cc(N)ccc1\N=C(\N)/Nc2cccc(O)c2
Formula C14H16N4O
Molecular Weight 256.30 da
Stereocenters 0/0