Target Relevance

Molecular Definition

Canonical SMILES CNC(=O)[C@@H](NC(=O)C(CCc1ccccc1)CP(=O)(O)Cc2ccc(Cc3ccc(F)cc3)cc2)C(C)(C)C
Formula C32H40FN2O4P
Molecular Weight 566.64 da
Stereocenters 1/2