Molecular Definition

Canonical SMILES C[C@H](N1CCN(C[C@@H]1C)C2CCN(CC2)C(=O)c3c(N)cccc3Cl)c4ccc(cc4)S(=O)(=O)c5ccc6OCOc6c5
Formula C32H37ClN4O5S
Molecular Weight 625.18 da
Stereocenters 2/2