Target Relevance

Molecular Definition

Canonical SMILES COc1cc(OC2CCNCC2)ccc1C(=O)N3CCC(CC3)N4C(=O)OCc5ccccc45
Formula C26H31N3O5
Molecular Weight 465.54 da
Stereocenters 0/0