Target Relevance

Molecular Definition

Canonical SMILES CCc1ccc(cc1)S(=O)(=O)Nc2ccc(CCNC[C@H](O)COc3cccnc3)cc2
Formula C24H29N3O4S
Molecular Weight 455.57 da
Stereocenters 1/1