Target Relevance

Molecular Definition

Canonical SMILES OC(=O)c1cccc(c1)S(=O)(=O)N2C(=O)CN(C2=O)c3ccccc3
Formula C16H12N2O6S
Molecular Weight 360.34 da
Stereocenters 0/0