Target Relevance

Molecular Definition

Canonical SMILES c1ccc2[nH]c(nc2c1)c3cscn3
Formula C10H7N3S
Molecular Weight 201.25 da
Stereocenters 0/0