Molecular Definition

Canonical SMILES Oc1cc2C(=O)Oc3c(O)c(O)cc4C(=O)Oc(c1O)c2c34
Formula C14H6O8
Molecular Weight 302.19 da
Stereocenters 0/0